C40H55NO5Si — CID 11342782
[(4R,6S)-1-[tert-butyl(diphenyl)silyl]oxy-6-methyloct-7-en-4-yl] (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate (PubChem CID 11342782) has the molecular formula C40H55NO5Si and a molecular weight of 657.97 g/mol. Its IUPAC name is [(4R,6S)-1-[tert-butyl(diphenyl)silyl]oxy-6-methyloct-7-en-4-yl] (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate.
| Compound Name | [(4R,6S)-1-[tert-butyl(diphenyl)silyl]oxy-6-methyloct-7-en-4-yl] (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 11342782 |
| Molecular Formula | C40H55NO5Si |
| Molecular Weight | 657.97 g/mol |
| Exact Mass | 657.38 |
| IUPAC Name | [(4R,6S)-1-[tert-butyl(diphenyl)silyl]oxy-6-methyloct-7-en-4-yl] (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate |
| SMILES | C=C[C@@H](C)C[C@@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)[C@H](Cc1ccccc1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H55NO5Si/c1-10-31(2)29-33(45-37(42)36(30-32-21-14-11-15-22-32)41(9)38(43)46-39(3,4)5)23-20-28-44-47(40(6,7)8,34-24-16-12-17-25-34)35-26-18-13-19-27-35/h10-19,21-22,24-27,31,33,36H,1,20,23,28-30H2,2-9H3/t31-,33-,36+/m1/s1 |
| InChIKey | VVDSFXCFGYDCDK-VZDRTSEESA-N |
| XLogP | 7.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.97 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|