C44H61NO4Si — CID 102375028
[(4R,7S)-1-[tert-butyl(diphenyl)silyl]oxy-7-methylnon-8-en-4-yl] (2S)-2-[[(2R,4S)-2,4-dimethylhex-5-enoyl]-methylamino]-3-phenylpropanoate (PubChem CID 102375028) has the molecular formula C44H61NO4Si and a molecular weight of 696.06 g/mol. Its IUPAC name is [(4R,7S)-1-[tert-butyl(diphenyl)silyl]oxy-7-methylnon-8-en-4-yl] (2S)-2-[[(2R,4S)-2,4-dimethylhex-5-enoyl]-methylamino]-3-phenylpropanoate.
| Compound Name | [(4R,7S)-1-[tert-butyl(diphenyl)silyl]oxy-7-methylnon-8-en-4-yl] (2S)-2-[[(2R,4S)-2,4-dimethylhex-5-enoyl]-methylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 102375028 |
| Molecular Formula | C44H61NO4Si |
| Molecular Weight | 696.06 g/mol |
| Exact Mass | 695.44 |
| IUPAC Name | [(4R,7S)-1-[tert-butyl(diphenyl)silyl]oxy-7-methylnon-8-en-4-yl] (2S)-2-[[(2R,4S)-2,4-dimethylhex-5-enoyl]-methylamino]-3-phenylpropanoate |
| SMILES | C=C[C@@H](C)CC[C@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)[C@H](Cc1ccccc1)N(C)C(=O)[C@H](C)C[C@H](C)C=C |
| InChI | InChI=1S/C44H61NO4Si/c1-10-34(3)29-30-38(24-21-31-48-50(44(6,7)8,39-25-17-13-18-26-39)40-27-19-14-20-28-40)49-43(47)41(33-37-22-15-12-16-23-37)45(9)42(46)36(5)32-35(4)11-2/h10-20,22-23,25-28,34-36,38,41H,1-2,21,24,29-33H2,3-9H3/t34-,35-,36-,38+,41+/m1/s1 |
| InChIKey | QGNDEMDVVYLHDT-MISXLJOQSA-N |
| XLogP | 8.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.06 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|