C53H76O3Si2 — CID 160977015
tert-butyl-[(4S)-4,6-dimethylhept-6-enoxy]-diphenylsilane;(5S)-8-[tert-butyl(diphenyl)silyl]oxy-5-methyl-3-methylideneoctan-2-one;ethene (PubChem CID 160977015) has the molecular formula C53H76O3Si2 and a molecular weight of 817.36 g/mol. Its IUPAC name is tert-butyl-[(4S)-4,6-dimethylhept-6-enoxy]-diphenylsilane;(5S)-8-[tert-butyl(diphenyl)silyl]oxy-5-methyl-3-methylideneoctan-2-one;ethene.
| Compound Name | tert-butyl-[(4S)-4,6-dimethylhept-6-enoxy]-diphenylsilane;(5S)-8-[tert-butyl(diphenyl)silyl]oxy-5-methyl-3-methylideneoctan-2-one;ethene |
|---|---|
| PubChem CID | 160977015 |
| Molecular Formula | C53H76O3Si2 |
| Molecular Weight | 817.36 g/mol |
| Exact Mass | 816.53 |
| IUPAC Name | tert-butyl-[(4S)-4,6-dimethylhept-6-enoxy]-diphenylsilane;(5S)-8-[tert-butyl(diphenyl)silyl]oxy-5-methyl-3-methylideneoctan-2-one;ethene |
| SMILES | C=C.C=C(C)C[C@@H](C)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.C=C(C[C@@H](C)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)=O |
| InChI | InChI=1S/C26H36O2Si.C25H36OSi.C2H4/c1-21(20-22(2)23(3)27)14-13-19-28-29(26(4,5)6,24-15-9-7-10-16-24)25-17-11-8-12-18-25;1-21(2)20-22(3)14-13-19-26-27(25(4,5)6,23-15-9-7-10-16-23)24-17-11-8-12-18-24;1-2/h7-12,15-18,21H,2,13-14,19-20H2,1,3-6H3;7-12,15-18,22H,1,13-14,19-20H2,2-6H3;1-2H2/t21-;22-;/m00./s1 |
| InChIKey | SYZSBMVGDIABPT-OYLDSLEESA-N |
| XLogP | 12.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.36 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|