C21H28N2O7Si — CID 58812389
[(2S)-5-[tert-butyl(diphenyl)silyl]oxy-1-nitrooxypentan-2-yl] nitrate (PubChem CID 58812389) has the molecular formula C21H28N2O7Si and a molecular weight of 448.55 g/mol. Its IUPAC name is [(2S)-5-[tert-butyl(diphenyl)silyl]oxy-1-nitrooxypentan-2-yl] nitrate.
| Compound Name | [(2S)-5-[tert-butyl(diphenyl)silyl]oxy-1-nitrooxypentan-2-yl] nitrate |
|---|---|
| PubChem CID | 58812389 |
| Molecular Formula | C21H28N2O7Si |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | [(2S)-5-[tert-butyl(diphenyl)silyl]oxy-1-nitrooxypentan-2-yl] nitrate |
| SMILES | CC(C)(C)[Si](OCCC[C@@H](CO[N+](=O)[O-])O[N+](=O)[O-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O7Si/c1-21(2,3)31(19-12-6-4-7-13-19,20-14-8-5-9-15-20)29-16-10-11-18(30-23(26)27)17-28-22(24)25/h4-9,12-15,18H,10-11,16-17H2,1-3H3/t18-/m0/s1 |
| InChIKey | LOKZNWOHELXVHS-SFHVURJKSA-N |
| XLogP | 3.13 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|