C28H36O3SSi — CID 25117682
[(4R)-5-(benzenesulfonyl)-4-methylpentoxy]-tert-butyl-diphenylsilane (PubChem CID 25117682) has the molecular formula C28H36O3SSi and a molecular weight of 480.75 g/mol. Its IUPAC name is [(4R)-5-(benzenesulfonyl)-4-methylpentoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(4R)-5-(benzenesulfonyl)-4-methylpentoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 25117682 |
| Molecular Formula | C28H36O3SSi |
| Molecular Weight | 480.75 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | [(4R)-5-(benzenesulfonyl)-4-methylpentoxy]-tert-butyl-diphenylsilane |
| SMILES | C[C@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H36O3SSi/c1-24(23-32(29,30)25-16-8-5-9-17-25)15-14-22-31-33(28(2,3)4,26-18-10-6-11-19-26)27-20-12-7-13-21-27/h5-13,16-21,24H,14-15,22-23H2,1-4H3/t24-/m1/s1 |
| InChIKey | DFYGEJQDBCBLJD-XMMPIXPASA-N |
| XLogP | 5.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.75 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|