C33H37FO3SSi — CID 10578797
tert-butyl-[4-(4-fluorophenyl)sulfonyl-5-phenylpentoxy]-diphenylsilane (PubChem CID 10578797) has the molecular formula C33H37FO3SSi and a molecular weight of 560.81 g/mol. Its IUPAC name is tert-butyl-[4-(4-fluorophenyl)sulfonyl-5-phenylpentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[4-(4-fluorophenyl)sulfonyl-5-phenylpentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10578797 |
| Molecular Formula | C33H37FO3SSi |
| Molecular Weight | 560.81 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | tert-butyl-[4-(4-fluorophenyl)sulfonyl-5-phenylpentoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCC(Cc1ccccc1)S(=O)(=O)c1ccc(F)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H37FO3SSi/c1-33(2,3)39(31-17-9-5-10-18-31,32-19-11-6-12-20-32)37-25-13-16-30(26-27-14-7-4-8-15-27)38(35,36)29-23-21-28(34)22-24-29/h4-12,14-15,17-24,30H,13,16,25-26H2,1-3H3 |
| InChIKey | DHPAUBXBKVSDGN-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.81 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|