C30H40O4SSi — CID 59759753
[6-[tert-butyl(diphenyl)silyl]oxy-2-methylhexan-3-yl] 4-methylbenzenesulfonate (PubChem CID 59759753) has the molecular formula C30H40O4SSi and a molecular weight of 524.80 g/mol. Its IUPAC name is [6-[tert-butyl(diphenyl)silyl]oxy-2-methylhexan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [6-[tert-butyl(diphenyl)silyl]oxy-2-methylhexan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59759753 |
| Molecular Formula | C30H40O4SSi |
| Molecular Weight | 524.80 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | [6-[tert-butyl(diphenyl)silyl]oxy-2-methylhexan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C30H40O4SSi/c1-24(2)29(34-35(31,32)26-21-19-25(3)20-22-26)18-13-23-33-36(30(4,5)6,27-14-9-7-10-15-27)28-16-11-8-12-17-28/h7-12,14-17,19-22,24,29H,13,18,23H2,1-6H3 |
| InChIKey | DNCRXWUOWHOFCH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.80 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|