C27H34O4SSi — CID 14446829
[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl] 4-methylbenzenesulfonate (PubChem CID 14446829) has the molecular formula C27H34O4SSi and a molecular weight of 482.72 g/mol. Its IUPAC name is [(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14446829 |
| Molecular Formula | C27H34O4SSi |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H34O4SSi/c1-22-16-18-24(19-17-22)32(28,29)30-20-23(2)21-31-33(27(3,4)5,25-12-8-6-9-13-25)26-14-10-7-11-15-26/h6-19,23H,20-21H2,1-5H3/t23-/m0/s1 |
| InChIKey | CLVZBYZRXQTMOD-QHCPKHFHSA-N |
| XLogP | 4.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|