C28H34O6SSi — CID 171126800
[(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl] 4-methylbenzenesulfonate (PubChem CID 171126800) has the molecular formula C28H34O6SSi and a molecular weight of 526.73 g/mol. Its IUPAC name is [(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171126800 |
| Molecular Formula | C28H34O6SSi |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | [(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CC(O)O[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H34O6SSi/c1-21-15-17-22(18-16-21)35(30,31)34-25-19-27(29)33-26(25)20-32-36(28(2,3)4,23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-18,25-27,29H,19-20H2,1-4H3/t25-,26+,27?/m0/s1 |
| InChIKey | JLWOZNQQDOFPSF-AJRFNQODSA-N |
| XLogP | 3.75 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|