C29H35NO5SSi — CID 11145937
(5S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-1-(4-methylphenyl)sulfonylpiperidin-2-one (PubChem CID 11145937) has the molecular formula C29H35NO5SSi and a molecular weight of 537.75 g/mol. Its IUPAC name is (5S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-1-(4-methylphenyl)sulfonylpiperidin-2-one.
| Compound Name | (5S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-1-(4-methylphenyl)sulfonylpiperidin-2-one |
|---|---|
| PubChem CID | 11145937 |
| Molecular Formula | C29H35NO5SSi |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | (5S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-1-(4-methylphenyl)sulfonylpiperidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)CC[C@H](O)[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H35NO5SSi/c1-22-15-17-23(18-16-22)36(33,34)30-26(27(31)19-20-28(30)32)21-35-37(29(2,3)4,24-11-7-5-8-12-24)25-13-9-6-10-14-25/h5-18,26-27,31H,19-21H2,1-4H3/t26-,27-/m0/s1 |
| InChIKey | MMGQWZLOGIVAHK-SVBPBHIXSA-N |
| XLogP | 3.61 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|