C30H37NO4SSi — CID 11006007
(2E)-2-[(5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]ethanol (PubChem CID 11006007) has the molecular formula C30H37NO4SSi and a molecular weight of 535.78 g/mol. Its IUPAC name is (2E)-2-[(5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]ethanol.
| Compound Name | (2E)-2-[(5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]ethanol |
|---|---|
| PubChem CID | 11006007 |
| Molecular Formula | C30H37NO4SSi |
| Molecular Weight | 535.78 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | (2E)-2-[(5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]ethanol |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C/CO)C[C@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H37NO4SSi/c1-24-15-17-27(18-16-24)36(33,34)31-22-25(19-20-32)21-26(31)23-35-37(30(2,3)4,28-11-7-5-8-12-28)29-13-9-6-10-14-29/h5-19,26,32H,20-23H2,1-4H3/b25-19+/t26-/m0/s1 |
| InChIKey | MAZUCWKYHTWOOQ-HZBNVGEHSA-N |
| XLogP | 4.25 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.78 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|