C26H37NO3PSSi+ — CID 91124719
[tert-butyl-[[3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.1.0]heptan-4-yl]methoxy]-phenylsilyl]-methyl-methylidenephosphanium (PubChem CID 91124719) has the molecular formula C26H37NO3PSSi+ and a molecular weight of 502.71 g/mol. Its IUPAC name is [tert-butyl-[[3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.1.0]heptan-4-yl]methoxy]-phenylsilyl]-methyl-methylidenephosphanium.
| Compound Name | [tert-butyl-[[3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.1.0]heptan-4-yl]methoxy]-phenylsilyl]-methyl-methylidenephosphanium |
|---|---|
| PubChem CID | 91124719 |
| Molecular Formula | C26H37NO3PSSi+ |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | [tert-butyl-[[3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.1.0]heptan-4-yl]methoxy]-phenylsilyl]-methyl-methylidenephosphanium |
| SMILES | C=[P+](C)[Si](OCC1CC2CC2CN1S(=O)(=O)c1ccc(C)cc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H37NO3PSSi/c1-20-12-14-24(15-13-20)32(28,29)27-18-22-16-21(22)17-23(27)19-30-33(31(5)6,26(2,3)4)25-10-8-7-9-11-25/h7-15,21-23H,5,16-19H2,1-4,6H3/q+1 |
| InChIKey | QPMSVGYTTOHIMC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|