C22H30N4O3SSi — CID 140846362
[(2S,4R)-4-azido-1-methylsulfonylpyrrolidin-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 140846362) has the molecular formula C22H30N4O3SSi and a molecular weight of 458.66 g/mol. Its IUPAC name is [(2S,4R)-4-azido-1-methylsulfonylpyrrolidin-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S,4R)-4-azido-1-methylsulfonylpyrrolidin-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 140846362 |
| Molecular Formula | C22H30N4O3SSi |
| Molecular Weight | 458.66 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | [(2S,4R)-4-azido-1-methylsulfonylpyrrolidin-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@H](N=[N+]=[N-])CN1S(C)(=O)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30N4O3SSi/c1-22(2,3)31(20-11-7-5-8-12-20,21-13-9-6-10-14-21)29-17-19-15-18(24-25-23)16-26(19)30(4,27)28/h5-14,18-19H,15-17H2,1-4H3/t18-,19+/m1/s1 |
| InChIKey | FSPFZGFTUQDQEX-MOPGFXCFSA-N |
| XLogP | 3.28 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.66 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|