C21H25N3O3Si — CID 11954841
(3S,5R)-3-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-one (PubChem CID 11954841) has the molecular formula C21H25N3O3Si and a molecular weight of 395.54 g/mol. Its IUPAC name is (3S,5R)-3-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-one.
| Compound Name | (3S,5R)-3-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 11954841 |
| Molecular Formula | C21H25N3O3Si |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (3S,5R)-3-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1C[C@H](N=[N+]=[N-])C(=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O3Si/c1-21(2,3)28(17-10-6-4-7-11-17,18-12-8-5-9-13-18)26-15-16-14-19(23-24-22)20(25)27-16/h4-13,16,19H,14-15H2,1-3H3/t16-,19+/m1/s1 |
| InChIKey | FDQWEIQUWJKIGO-APWZRJJASA-N |
| XLogP | 3.56 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|