C26H31N5O3SSi — CID 101196334
1-[(3S,5S)-3-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 101196334) has the molecular formula C26H31N5O3SSi and a molecular weight of 521.72 g/mol. Its IUPAC name is 1-[(3S,5S)-3-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(3S,5S)-3-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101196334 |
| Molecular Formula | C26H31N5O3SSi |
| Molecular Weight | 521.72 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | 1-[(3S,5S)-3-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C2S[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@@H]2N=[N+]=[N-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H31N5O3SSi/c1-18-16-31(25(33)28-23(18)32)24-22(29-30-27)15-19(35-24)17-34-36(26(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,16,19,22,24H,15,17H2,1-4H3,(H,28,32,33)/t19-,22-,24?/m0/s1 |
| InChIKey | CQWLPUDTUBJVFH-XUPADYDASA-N |
| XLogP | 4.10 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.72 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|