C30H29N5O3 — CID 54221501
1-[(1S,3S,4R)-3-azido-4-(trityloxymethyl)cyclopentyl]-5-methylpyrimidine-2,4-dione (PubChem CID 54221501) has the molecular formula C30H29N5O3 and a molecular weight of 507.59 g/mol. Its IUPAC name is 1-[(1S,3S,4R)-3-azido-4-(trityloxymethyl)cyclopentyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1S,3S,4R)-3-azido-4-(trityloxymethyl)cyclopentyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54221501 |
| Molecular Formula | C30H29N5O3 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 1-[(1S,3S,4R)-3-azido-4-(trityloxymethyl)cyclopentyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H](N=[N+]=[N-])C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C30H29N5O3/c1-21-19-35(29(37)32-28(21)36)26-17-22(27(18-26)33-34-31)20-38-30(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-16,19,22,26-27H,17-18,20H2,1H3,(H,32,36,37)/t22-,26-,27-/m0/s1 |
| InChIKey | QCXDCTTVRRJYOY-CAVYSCNFSA-N |
| XLogP | 5.48 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|