C35H42N2O3SSi — CID 11635730
5-methyl-1-[(1R,3S,4R)-3-(2-trimethylsilylethylsulfanyl)-4-(trityloxymethyl)cyclopentyl]pyrimidine-2,4-dione (PubChem CID 11635730) has the molecular formula C35H42N2O3SSi and a molecular weight of 598.89 g/mol. Its IUPAC name is 5-methyl-1-[(1R,3S,4R)-3-(2-trimethylsilylethylsulfanyl)-4-(trityloxymethyl)cyclopentyl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(1R,3S,4R)-3-(2-trimethylsilylethylsulfanyl)-4-(trityloxymethyl)cyclopentyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11635730 |
| Molecular Formula | C35H42N2O3SSi |
| Molecular Weight | 598.89 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | 5-methyl-1-[(1R,3S,4R)-3-(2-trimethylsilylethylsulfanyl)-4-(trityloxymethyl)cyclopentyl]pyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2C[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H](SCC[Si](C)(C)C)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C35H42N2O3SSi/c1-26-24-37(34(39)36-33(26)38)31-22-27(32(23-31)41-20-21-42(2,3)4)25-40-35(28-14-8-5-9-15-28,29-16-10-6-11-17-29)30-18-12-7-13-19-30/h5-19,24,27,31-32H,20-23,25H2,1-4H3,(H,36,38,39)/t27-,31-,32+/m1/s1 |
| InChIKey | URFUVWZFMQXHKZ-HPENDQLSSA-N |
| XLogP | 7.24 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.89 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|