C40H40N2O6 — CID 100970250
[(1S,2R,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)cyclohexyl] (2R)-2-methoxy-2-phenylacetate (PubChem CID 100970250) has the molecular formula C40H40N2O6 and a molecular weight of 644.77 g/mol. Its IUPAC name is [(1S,2R,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)cyclohexyl] (2R)-2-methoxy-2-phenylacetate.
| Compound Name | [(1S,2R,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)cyclohexyl] (2R)-2-methoxy-2-phenylacetate |
|---|---|
| PubChem CID | 100970250 |
| Molecular Formula | C40H40N2O6 |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.29 |
| IUPAC Name | [(1S,2R,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)cyclohexyl] (2R)-2-methoxy-2-phenylacetate |
| SMILES | CO[C@@H](C(=O)O[C@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)CC[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H40N2O6/c1-28-26-42(39(45)41-37(28)43)34-24-23-30(35(25-34)48-38(44)36(46-2)29-15-7-3-8-16-29)27-47-40(31-17-9-4-10-18-31,32-19-11-5-12-20-32)33-21-13-6-14-22-33/h3-22,26,30,34-36H,23-25,27H2,1-2H3,(H,41,43,45)/t30-,34-,35+,36-/m1/s1 |
| InChIKey | RPJIWAFHJTWTFJ-XXSYETNWSA-N |
| XLogP | 6.49 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|