C30H30N2O6 — CID 67748612
1-[(2R,4S,5R)-4-hydroxy-5-[[(2-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 67748612) has the molecular formula C30H30N2O6 and a molecular weight of 514.58 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-[[(2-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-[[(2-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67748612 |
| Molecular Formula | C30H30N2O6 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-[[(2-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccccc1C(OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H30N2O6/c1-20-18-32(29(35)31-28(20)34)27-17-24(33)26(38-27)19-37-30(21-11-5-3-6-12-21,22-13-7-4-8-14-22)23-15-9-10-16-25(23)36-2/h3-16,18,24,26-27,33H,17,19H2,1-2H3,(H,31,34,35)/t24-,26+,27+/m0/s1 |
| InChIKey | QDZUTSSXLZJIDF-WYMJOSIYSA-N |
| XLogP | 3.51 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|