C29H28N2O6 — CID 14352037
1-[3,4-dihydroxy-5-(trityloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 14352037) has the molecular formula C29H28N2O6 and a molecular weight of 500.55 g/mol. Its IUPAC name is 1-[3,4-dihydroxy-5-(trityloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[3,4-dihydroxy-5-(trityloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 14352037 |
| Molecular Formula | C29H28N2O6 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 1-[3,4-dihydroxy-5-(trityloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C2OC(COC(c3ccccc3)(c3ccccc3)c3ccccc3)C(O)C2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C29H28N2O6/c1-19-17-31(28(35)30-26(19)34)27-25(33)24(32)23(37-27)18-36-29(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-17,23-25,27,32-33H,18H2,1H3,(H,30,34,35) |
| InChIKey | UOKLCXZVJVFUGB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|