C30H29FN2O7S — CID 14752962
[4-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl] methanesulfonate (PubChem CID 14752962) has the molecular formula C30H29FN2O7S and a molecular weight of 580.63 g/mol. Its IUPAC name is [4-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl] methanesulfonate.
| Compound Name | [4-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 14752962 |
| Molecular Formula | C30H29FN2O7S |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | [4-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl] methanesulfonate |
| SMILES | Cc1cn(C2OC(COC(c3ccccc3)(c3ccccc3)c3ccccc3)C(OS(C)(=O)=O)C2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C30H29FN2O7S/c1-20-18-33(29(35)32-27(20)34)28-25(31)26(40-41(2,36)37)24(39-28)19-38-30(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-18,24-26,28H,19H2,1-2H3,(H,32,34,35) |
| InChIKey | UAARHHOLHGXMMT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|