C36H43FN2O6Si — CID 169068512
1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 169068512) has the molecular formula C36H43FN2O6Si and a molecular weight of 646.83 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169068512 |
| Molecular Formula | C36H43FN2O6Si |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.29 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(O[C@H]2[C@@H](F)[C@H](n3cc(C)c(=O)[nH]c3=O)O[C@@H]2CO[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H43FN2O6Si/c1-24-22-39(34(41)38-32(24)40)33-30(37)31(29(44-33)23-43-46(6,7)35(2,3)4)45-36(25-14-10-8-11-15-25,26-16-12-9-13-17-26)27-18-20-28(42-5)21-19-27/h8-22,29-31,33H,23H2,1-7H3,(H,38,40,41)/t29-,30-,31-,33-/m1/s1 |
| InChIKey | HGGLYYFDOAWCDU-WTGZKXAYSA-N |
| XLogP | 6.49 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|