C31H31N5O8S — CID 11767380
[(2R,3S,4R,5S)-4-azido-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate (PubChem CID 11767380) has the molecular formula C31H31N5O8S and a molecular weight of 633.68 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-4-azido-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3S,4R,5S)-4-azido-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 11767380 |
| Molecular Formula | C31H31N5O8S |
| Molecular Weight | 633.68 g/mol |
| Exact Mass | 633.19 |
| IUPAC Name | [(2R,3S,4R,5S)-4-azido-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)[C@@H](OS(C)(=O)=O)[C@@H]2N=[N+]=[N-])(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H31N5O8S/c1-20-18-36(30(38)33-28(20)37)29-27(44-45(3,39)40)26(34-35-32)25(43-29)19-42-31(21-10-6-4-7-11-21,22-12-8-5-9-13-22)23-14-16-24(41-2)17-15-23/h4-18,25-27,29H,19H2,1-3H3,(H,33,37,38)/t25-,26-,27+,29-/m1/s1 |
| InChIKey | OVCTVPGWZHILQR-CITHKVLSSA-N |
| XLogP | 3.78 |
| TPSA | 174.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.68 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|