C35H40N2O13P+ — CID 70013106
dihydroxy(oxo)phosphanium;ethyl 2-[(2S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyacetate (PubChem CID 70013106) has the molecular formula C35H40N2O13P+ and a molecular weight of 727.68 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;ethyl 2-[(2S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyacetate.
| Compound Name | dihydroxy(oxo)phosphanium;ethyl 2-[(2S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyacetate |
|---|---|
| PubChem CID | 70013106 |
| Molecular Formula | C35H40N2O13P+ |
| Molecular Weight | 727.68 g/mol |
| Exact Mass | 727.23 |
| IUPAC Name | dihydroxy(oxo)phosphanium;ethyl 2-[(2S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyacetate |
| SMILES | CCOC(=O)COC1C(O)[C@H](COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O[C@@H]1n1cc(C)c(=O)[nH]c1=O.O=[P+](O)O |
| InChI | InChI=1S/C35H38N2O10.HO3P/c1-5-44-29(38)21-45-31-30(39)28(47-33(31)37-19-22(2)32(40)36-34(37)41)20-46-35(23-9-7-6-8-10-23,24-11-15-26(42-3)16-12-24)25-13-17-27(43-4)18-14-25;1-4(2)3/h6-19,28,30-31,33,39H,5,20-21H2,1-4H3,(H,36,40,41);(H-,1,2,3)/p+1/t28-,30?,31?,33-;/m0./s1 |
| InChIKey | WNNUQANCFHLASQ-WOZHTFAKSA-O |
| XLogP | 2.71 |
| TPSA | 205.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.68 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|