C52H73N3O9 — CID 170709493
2-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]oxy-N,N-didecylacetamide (PubChem CID 170709493) has the molecular formula C52H73N3O9 and a molecular weight of 884.17 g/mol. Its IUPAC name is 2-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]oxy-N,N-didecylacetamide.
| Compound Name | 2-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]oxy-N,N-didecylacetamide |
|---|---|
| PubChem CID | 170709493 |
| Molecular Formula | C52H73N3O9 |
| Molecular Weight | 884.17 g/mol |
| Exact Mass | 883.53 |
| IUPAC Name | 2-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]oxy-N,N-didecylacetamide |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)C(=O)COC1C(O)[C@@H](COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C52H73N3O9/c1-5-7-9-11-13-15-17-22-35-54(36-23-18-16-14-12-10-8-6-2)47(57)39-62-49-48(58)45(64-50(49)55-37-34-46(56)53-51(55)59)38-63-52(40-24-20-19-21-25-40,41-26-30-43(60-3)31-27-41)42-28-32-44(61-4)33-29-42/h19-21,24-34,37,45,48-50,58H,5-18,22-23,35-36,38-39H2,1-4H3,(H,53,56,59)/t45-,48?,49?,50-/m1/s1 |
| InChIKey | IEVCLISWGZLEJC-GDGDCZKFSA-N |
| XLogP | 9.32 |
| TPSA | 141.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.17 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|