C40H36N2O8 — CID 71235599
1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-naphthalen-1-yloxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 71235599) has the molecular formula C40H36N2O8 and a molecular weight of 672.73 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-naphthalen-1-yloxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-naphthalen-1-yloxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71235599 |
| Molecular Formula | C40H36N2O8 |
| Molecular Weight | 672.73 g/mol |
| Exact Mass | 672.25 |
| IUPAC Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-naphthalen-1-yloxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)C(Oc3cccc4ccccc34)[C@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H36N2O8/c1-46-30-19-15-28(16-20-30)40(27-11-4-3-5-12-27,29-17-21-31(47-2)22-18-29)48-25-34-36(44)37(38(50-34)42-24-23-35(43)41-39(42)45)49-33-14-8-10-26-9-6-7-13-32(26)33/h3-24,34,36-38,44H,25H2,1-2H3,(H,41,43,45)/t34-,36+,37?,38-/m1/s1 |
| InChIKey | UTYVCDVVVVOARU-GUEFLFOISA-N |
| XLogP | 5.42 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.73 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|