C31H32N2O7 — CID 10674089
1-[(2R,3R,4S,5R)-4-hydroxy-3-[(1S)-1-hydroxyethyl]-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 10674089) has the molecular formula C31H32N2O7 and a molecular weight of 544.60 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-4-hydroxy-3-[(1S)-1-hydroxyethyl]-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-4-hydroxy-3-[(1S)-1-hydroxyethyl]-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10674089 |
| Molecular Formula | C31H32N2O7 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-4-hydroxy-3-[(1S)-1-hydroxyethyl]-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H]([C@H](C)O)[C@@H]2O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H32N2O7/c1-20(34)27-28(36)25(40-29(27)33-18-17-26(35)32-30(33)37)19-39-31(21-9-5-3-6-10-21,22-11-7-4-8-12-22)23-13-15-24(38-2)16-14-23/h3-18,20,25,27-29,34,36H,19H2,1-2H3,(H,32,35,37)/t20-,25+,27+,28+,29+/m0/s1 |
| InChIKey | JZBJSFXXMRAYBY-FFUBYKQVSA-N |
| XLogP | 2.81 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|