C32H31N3O7 — CID 102150200
2-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]acetonitrile (PubChem CID 102150200) has the molecular formula C32H31N3O7 and a molecular weight of 569.61 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]acetonitrile.
| Compound Name | 2-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]acetonitrile |
|---|---|
| PubChem CID | 102150200 |
| Molecular Formula | C32H31N3O7 |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | 2-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]acetonitrile |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](CC#N)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H31N3O7/c1-39-24-12-8-22(9-13-24)32(21-6-4-3-5-7-21,23-10-14-25(40-2)15-11-23)41-20-27-29(37)26(16-18-33)30(42-27)35-19-17-28(36)34-31(35)38/h3-15,17,19,26-27,29-30,37H,16,20H2,1-2H3,(H,34,36,38)/t26-,27-,29+,30-/m1/s1 |
| InChIKey | FPBIZGKUXVFZGZ-SHHHLKPLSA-N |
| XLogP | 3.35 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|