C35H38N2O9 — CID 11734856
1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(oxan-2-yloxy)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 11734856) has the molecular formula C35H38N2O9 and a molecular weight of 630.69 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(oxan-2-yloxy)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(oxan-2-yloxy)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11734856 |
| Molecular Formula | C35H38N2O9 |
| Molecular Weight | 630.69 g/mol |
| Exact Mass | 630.26 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(oxan-2-yloxy)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](OC3CCCCO3)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H38N2O9/c1-41-26-15-11-24(12-16-26)35(23-8-4-3-5-9-23,25-13-17-27(42-2)18-14-25)44-22-28-31(39)32(46-30-10-6-7-21-43-30)33(45-28)37-20-19-29(38)36-34(37)40/h3-5,8-9,11-20,28,30-33,39H,6-7,10,21-22H2,1-2H3,(H,36,38,40)/t28-,30?,31-,32-,33-/m1/s1 |
| InChIKey | IWOLKNXGXZJHEV-SFJYDLPDSA-N |
| XLogP | 3.73 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.69 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|