C36H40N2O8 — CID 54247718
1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hex-1-enoxy-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 54247718) has the molecular formula C36H40N2O8 and a molecular weight of 628.72 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hex-1-enoxy-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hex-1-enoxy-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54247718 |
| Molecular Formula | C36H40N2O8 |
| Molecular Weight | 628.72 g/mol |
| Exact Mass | 628.28 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hex-1-enoxy-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCCCC=CO[C@@H]1[C@H](O)[C@@H](COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C36H40N2O8/c1-4-5-6-10-23-44-33-32(40)30(46-34(33)38-22-21-31(39)37-35(38)41)24-45-36(25-11-8-7-9-12-25,26-13-17-28(42-2)18-14-26)27-15-19-29(43-3)20-16-27/h7-23,30,32-34,40H,4-6,24H2,1-3H3,(H,37,39,41)/t30-,32-,33-,34-/m1/s1 |
| InChIKey | QUMDVAKKVIEHJW-DWNQJFHRSA-N |
| XLogP | 4.91 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.72 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|