C33H36N2O9S — CID 176885427
1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(methylsulfanylmethoxymethoxy)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 176885427) has the molecular formula C33H36N2O9S and a molecular weight of 636.72 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(methylsulfanylmethoxymethoxy)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(methylsulfanylmethoxymethoxy)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 176885427 |
| Molecular Formula | C33H36N2O9S |
| Molecular Weight | 636.72 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(methylsulfanylmethoxymethoxy)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](OCOCSC)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H36N2O9S/c1-39-25-13-9-23(10-14-25)33(22-7-5-4-6-8-22,24-11-15-26(40-2)16-12-24)43-19-27-29(37)30(42-20-41-21-45-3)31(44-27)35-18-17-28(36)34-32(35)38/h4-18,27,29-31,37H,19-21H2,1-3H3,(H,34,36,38)/t27-,29-,30-,31-/m1/s1 |
| InChIKey | MFEDXUTZHCNAPA-PMFUCWTESA-N |
| XLogP | 3.50 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.72 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|