C32H30F3N3O8 — CID 57288277
N-[(2S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 57288277) has the molecular formula C32H30F3N3O8 and a molecular weight of 641.60 g/mol. Its IUPAC name is N-[(2S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 57288277 |
| Molecular Formula | C32H30F3N3O8 |
| Molecular Weight | 641.60 g/mol |
| Exact Mass | 641.20 |
| IUPAC Name | N-[(2S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccc(C(OC[C@@H]2O[C@H](n3ccc(=O)[nH]c3=O)C(NC(=O)C(F)(F)F)C2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H30F3N3O8/c1-43-22-12-8-20(9-13-22)31(19-6-4-3-5-7-19,21-10-14-23(44-2)15-11-21)45-18-24-27(40)26(37-29(41)32(33,34)35)28(46-24)38-17-16-25(39)36-30(38)42/h3-17,24,26-28,40H,18H2,1-2H3,(H,37,41)(H,36,39,42)/t24-,26?,27?,28-/m0/s1 |
| InChIKey | YXCGJVZWZXPKKD-VODUCOMMSA-N |
| XLogP | 2.87 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.60 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|