C38H43N3O11 — CID 101090182
3-[(2R,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-(dimethylamino)ethoxy]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-3-oxopropanoic acid (PubChem CID 101090182) has the molecular formula C38H43N3O11 and a molecular weight of 717.77 g/mol. Its IUPAC name is 3-[(2R,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-(dimethylamino)ethoxy]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-3-oxopropanoic acid.
| Compound Name | 3-[(2R,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-(dimethylamino)ethoxy]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 101090182 |
| Molecular Formula | C38H43N3O11 |
| Molecular Weight | 717.77 g/mol |
| Exact Mass | 717.29 |
| IUPAC Name | 3-[(2R,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-(dimethylamino)ethoxy]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-3-oxopropanoic acid |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)[C@H](OCCN(C)C)[C@@H]2OC(=O)CC(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H43N3O11/c1-24-22-41(37(46)39-35(24)45)36-34(49-20-19-40(2)3)33(52-32(44)21-31(42)43)30(51-36)23-50-38(25-9-7-6-8-10-25,26-11-15-28(47-4)16-12-26)27-13-17-29(48-5)18-14-27/h6-18,22,30,33-34,36H,19-21,23H2,1-5H3,(H,42,43)(H,39,45,46)/t30-,33-,34-,36-/m1/s1 |
| InChIKey | JGQFEJDJDOBZDF-UTBREEANSA-N |
| XLogP | 3.10 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|