C32H33FN2O6 — CID 10437794
1-[(1S,2S,3R,4S)-3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-fluoro-4-hydroxycyclopentyl]-5-methylpyrimidine-2,4-dione (PubChem CID 10437794) has the molecular formula C32H33FN2O6 and a molecular weight of 560.62 g/mol. Its IUPAC name is 1-[(1S,2S,3R,4S)-3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-fluoro-4-hydroxycyclopentyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1S,2S,3R,4S)-3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-fluoro-4-hydroxycyclopentyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10437794 |
| Molecular Formula | C32H33FN2O6 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 1-[(1S,2S,3R,4S)-3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-fluoro-4-hydroxycyclopentyl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2[C@H](F)[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H33FN2O6/c1-20-18-35(31(38)34-30(20)37)27-17-28(36)26(29(27)33)19-41-32(21-7-5-4-6-8-21,22-9-13-24(39-2)14-10-22)23-11-15-25(40-3)16-12-23/h4-16,18,26-29,36H,17,19H2,1-3H3,(H,34,37,38)/t26-,27+,28+,29+/m1/s1 |
| InChIKey | DXDHQBARRCLMIG-VVZGZWEYSA-N |
| XLogP | 4.13 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|