C36H41N5O9SSi — CID 101035848
[(2R,3R,4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate (PubChem CID 101035848) has the molecular formula C36H41N5O9SSi and a molecular weight of 747.90 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 101035848 |
| Molecular Formula | C36H41N5O9SSi |
| Molecular Weight | 747.90 g/mol |
| Exact Mass | 747.24 |
| IUPAC Name | [(2R,3R,4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)(COS(=O)(=O)c2ccc(C)cc2)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C36H41N5O9SSi/c1-24-17-19-27(20-18-24)51(45,46)47-22-36(23-48-52(35(4,5)6,28-13-9-7-10-14-28)29-15-11-8-12-16-29)31(39-40-37)30(49-26(3)42)33(50-36)41-21-25(2)32(43)38-34(41)44/h7-21,30-31,33H,22-23H2,1-6H3,(H,38,43,44)/t30-,31+,33-,36-/m1/s1 |
| InChIKey | SPOLIIZEISREHZ-KMYBWBIFSA-N |
| XLogP | 4.01 |
| TPSA | 191.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.90 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|