C29H34N2O5Si — CID 67024504
methyl 1-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(5-methyl-2,4-dioxopyrimidin-1-yl)cyclopent-2-ene-1-carboxylate (PubChem CID 67024504) has the molecular formula C29H34N2O5Si and a molecular weight of 518.69 g/mol. Its IUPAC name is methyl 1-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(5-methyl-2,4-dioxopyrimidin-1-yl)cyclopent-2-ene-1-carboxylate.
| Compound Name | methyl 1-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(5-methyl-2,4-dioxopyrimidin-1-yl)cyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 67024504 |
| Molecular Formula | C29H34N2O5Si |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | methyl 1-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(5-methyl-2,4-dioxopyrimidin-1-yl)cyclopent-2-ene-1-carboxylate |
| SMILES | COC(=O)C1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=CC(n2cc(C)c(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C29H34N2O5Si/c1-21-19-31(27(34)30-25(21)32)22-16-17-29(18-22,26(33)35-5)20-36-37(28(2,3)4,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-17,19,22H,18,20H2,1-5H3,(H,30,32,34) |
| InChIKey | DCKQDLSOABIFJO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|