C29H32F2N2O5Si — CID 102483289
methyl (1S,4R)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,5-difluoro-4-(5-methyl-2,4-dioxopyrimidin-1-yl)cyclopent-2-ene-1-carboxylate (PubChem CID 102483289) has the molecular formula C29H32F2N2O5Si and a molecular weight of 554.67 g/mol. Its IUPAC name is methyl (1S,4R)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,5-difluoro-4-(5-methyl-2,4-dioxopyrimidin-1-yl)cyclopent-2-ene-1-carboxylate.
| Compound Name | methyl (1S,4R)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,5-difluoro-4-(5-methyl-2,4-dioxopyrimidin-1-yl)cyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 102483289 |
| Molecular Formula | C29H32F2N2O5Si |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | methyl (1S,4R)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,5-difluoro-4-(5-methyl-2,4-dioxopyrimidin-1-yl)cyclopent-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=C[C@@H](n2cc(C)c(=O)[nH]c2=O)C1(F)F |
| InChI | InChI=1S/C29H32F2N2O5Si/c1-20-18-33(26(36)32-24(20)34)23-16-17-28(25(35)37-5,29(23,30)31)19-38-39(27(2,3)4,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-18,23H,19H2,1-5H3,(H,32,34,36)/t23-,28+/m1/s1 |
| InChIKey | RSQMBRLXNWHAQH-LXFBAYGMSA-N |
| XLogP | 3.33 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|