C31H36N2O7Si — CID 56934502
[(2R,3R,3aS,7aR)-7a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,3,3a,5-tetrahydrofuro[3,2-b]pyran-3-yl] acetate (PubChem CID 56934502) has the molecular formula C31H36N2O7Si and a molecular weight of 576.72 g/mol. Its IUPAC name is [(2R,3R,3aS,7aR)-7a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,3,3a,5-tetrahydrofuro[3,2-b]pyran-3-yl] acetate.
| Compound Name | [(2R,3R,3aS,7aR)-7a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,3,3a,5-tetrahydrofuro[3,2-b]pyran-3-yl] acetate |
|---|---|
| PubChem CID | 56934502 |
| Molecular Formula | C31H36N2O7Si |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | [(2R,3R,3aS,7aR)-7a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,3,3a,5-tetrahydrofuro[3,2-b]pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@]2(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C=CCO[C@@H]12 |
| InChI | InChI=1S/C31H36N2O7Si/c1-21-19-33(29(36)32-27(21)35)28-25(39-22(2)34)26-31(40-28,17-12-18-37-26)20-38-41(30(3,4)5,23-13-8-6-9-14-23)24-15-10-7-11-16-24/h6-17,19,25-26,28H,18,20H2,1-5H3,(H,32,35,36)/t25-,26+,28-,31-/m1/s1 |
| InChIKey | DYLRTLFWUZIIMD-IWQUTFRXSA-N |
| XLogP | 2.58 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|