C36H39BrN2O7Si — CID 11664841
[(2S,3aS,5R,6R,6aR)-3a-(2-bromophenyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] acetate (PubChem CID 11664841) has the molecular formula C36H39BrN2O7Si and a molecular weight of 719.71 g/mol. Its IUPAC name is [(2S,3aS,5R,6R,6aR)-3a-(2-bromophenyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] acetate.
| Compound Name | [(2S,3aS,5R,6R,6aR)-3a-(2-bromophenyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] acetate |
|---|---|
| PubChem CID | 11664841 |
| Molecular Formula | C36H39BrN2O7Si |
| Molecular Weight | 719.71 g/mol |
| Exact Mass | 718.17 |
| IUPAC Name | [(2S,3aS,5R,6R,6aR)-3a-(2-bromophenyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2O[C@H](n3cc(C)c(=O)[nH]c3=O)C[C@@]2(c2ccccc2Br)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H39BrN2O7Si/c1-23-21-39(34(42)38-33(23)41)30-20-36(27-18-12-13-19-28(27)37)32(45-30)31(44-24(2)40)29(46-36)22-43-47(35(3,4)5,25-14-8-6-9-15-25)26-16-10-7-11-17-26/h6-19,21,29-32H,20,22H2,1-5H3,(H,38,41,42)/t29-,30+,31-,32-,36+/m1/s1 |
| InChIKey | LXWVMHIOMIRCMN-ZORDVFMASA-N |
| XLogP | 4.70 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|