C28H33N5O5Si — CID 154621004
1-[(1S,3R,4R,7S)-7-azido-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 154621004) has the molecular formula C28H33N5O5Si and a molecular weight of 547.69 g/mol. Its IUPAC name is 1-[(1S,3R,4R,7S)-7-azido-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1S,3R,4R,7S)-7-azido-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 154621004 |
| Molecular Formula | C28H33N5O5Si |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | 1-[(1S,3R,4R,7S)-7-azido-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@@]3(CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C(C)O[C@@H]2[C@@H]3N=[N+]=[N-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C28H33N5O5Si/c1-18-16-33(26(35)30-24(18)34)25-22-23(31-32-29)28(38-25,19(2)37-22)17-36-39(27(3,4)5,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-16,19,22-23,25H,17H2,1-5H3,(H,30,34,35)/t19?,22-,23+,25-,28+/m1/s1 |
| InChIKey | UBOOXZRIZQFNLG-IJEGJQQLSA-N |
| XLogP | 3.16 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|