C33H38N2O9SSi — CID 101162585
[(2S,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 101162585) has the molecular formula C33H38N2O9SSi and a molecular weight of 666.83 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101162585 |
| Molecular Formula | C33H38N2O9SSi |
| Molecular Weight | 666.83 g/mol |
| Exact Mass | 666.21 |
| IUPAC Name | [(2S,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@]2(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C33H38N2O9SSi/c1-23-15-17-24(18-16-23)45(40,41)42-21-33(29(38)28(37)30(44-33)35-20-19-27(36)34-31(35)39)22-43-46(32(2,3)4,25-11-7-5-8-12-25)26-13-9-6-10-14-26/h5-20,28-30,37-38H,21-22H2,1-4H3,(H,34,36,39)/t28-,29+,30-,33-/m1/s1 |
| InChIKey | HIKIPNCGZMKTCT-NDQSGYKOSA-N |
| XLogP | 1.82 |
| TPSA | 157.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.83 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|