C28H34N2O7Si — CID 45140036
1-[(1R,3R,4R,6S,7S)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-hydroxy-6-(methoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione (PubChem CID 45140036) has the molecular formula C28H34N2O7Si and a molecular weight of 538.67 g/mol. Its IUPAC name is 1-[(1R,3R,4R,6S,7S)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-hydroxy-6-(methoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R,3R,4R,6S,7S)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-hydroxy-6-(methoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 45140036 |
| Molecular Formula | C28H34N2O7Si |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 1-[(1R,3R,4R,6S,7S)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-hydroxy-6-(methoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione |
| SMILES | COC[C@@H]1O[C@H]2[C@H](n3ccc(=O)[nH]c3=O)O[C@]1(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]2O |
| InChI | InChI=1S/C28H34N2O7Si/c1-27(2,3)38(19-11-7-5-8-12-19,20-13-9-6-10-14-20)35-18-28-21(17-34-4)36-23(24(28)32)25(37-28)30-16-15-22(31)29-26(30)33/h5-16,21,23-25,32H,17-18H2,1-4H3,(H,29,31,33)/t21-,23+,24-,25+,28-/m0/s1 |
| InChIKey | BXVAAFFRQNBBEX-UINDLHFGSA-N |
| XLogP | 1.16 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|