C28H34N2O6SSi — CID 10721488
S-[[(2S,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]methyl] ethanethioate (PubChem CID 10721488) has the molecular formula C28H34N2O6SSi and a molecular weight of 554.74 g/mol. Its IUPAC name is S-[[(2S,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]methyl] ethanethioate.
| Compound Name | S-[[(2S,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 10721488 |
| Molecular Formula | C28H34N2O6SSi |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | S-[[(2S,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SC[C@H]1[C@@H](O)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H34N2O6SSi/c1-19(31)37-18-22-23(36-26(25(22)33)30-16-15-24(32)29-27(30)34)17-35-38(28(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-16,22-23,25-26,33H,17-18H2,1-4H3,(H,29,32,34)/t22-,23-,25-,26-/m1/s1 |
| InChIKey | LWBWIVYJBVLZOH-OQUNMALSSA-N |
| XLogP | 2.27 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|