C32H43N2O9PSi — CID 162406848
1-[(2R,3R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(Z)-3-diethoxyphosphorylprop-2-enoxy]-3-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 162406848) has the molecular formula C32H43N2O9PSi and a molecular weight of 658.76 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(Z)-3-diethoxyphosphorylprop-2-enoxy]-3-hydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(Z)-3-diethoxyphosphorylprop-2-enoxy]-3-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 162406848 |
| Molecular Formula | C32H43N2O9PSi |
| Molecular Weight | 658.76 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(Z)-3-diethoxyphosphorylprop-2-enoxy]-3-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCOP(=O)(/C=C\CO[C@H]1[C@@H](O)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCC |
| InChI | InChI=1S/C32H43N2O9PSi/c1-6-40-44(38,41-7-2)22-14-21-39-29-26(43-30(28(29)36)34-20-19-27(35)33-31(34)37)23-42-45(32(3,4)5,24-15-10-8-11-16-24)25-17-12-9-13-18-25/h8-20,22,26,28-30,36H,6-7,21,23H2,1-5H3,(H,33,35,37)/b22-14-/t26-,28-,29-,30-/m1/s1 |
| InChIKey | MXJRXDWYIMESRP-TYECZNRISA-N |
| XLogP | 3.54 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|