C16H17BrN2O5 — CID 70169760
1-[(2R,3R,4S,5S)-5-(bromomethyl)-3-hydroxy-4-phenylmethoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 70169760) has the molecular formula C16H17BrN2O5 and a molecular weight of 397.23 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-5-(bromomethyl)-3-hydroxy-4-phenylmethoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5S)-5-(bromomethyl)-3-hydroxy-4-phenylmethoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70169760 |
| Molecular Formula | C16H17BrN2O5 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-5-(bromomethyl)-3-hydroxy-4-phenylmethoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@H](CBr)[C@@H](OCc3ccccc3)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C16H17BrN2O5/c17-8-11-14(23-9-10-4-2-1-3-5-10)13(21)15(24-11)19-7-6-12(20)18-16(19)22/h1-7,11,13-15,21H,8-9H2,(H,18,20,22)/t11-,13-,14-,15-/m1/s1 |
| InChIKey | LHBMQRMQURBMSX-NMFUWQPSSA-N |
| XLogP | 0.78 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|