C37H36N2O6Se — CID 10897737
1-[(2R,3R,4S,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3-phenylselanyloxan-2-yl]pyrimidine-2,4-dione (PubChem CID 10897737) has the molecular formula C37H36N2O6Se and a molecular weight of 683.66 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3-phenylselanyloxan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3-phenylselanyloxan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10897737 |
| Molecular Formula | C37H36N2O6Se |
| Molecular Weight | 683.66 g/mol |
| Exact Mass | 684.17 |
| IUPAC Name | 1-[(2R,3R,4S,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3-phenylselanyloxan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2[Se]c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C37H36N2O6Se/c40-32-21-22-39(37(41)38-32)36-35(46-30-19-11-4-12-20-30)34(44-25-29-17-9-3-10-18-29)33(43-24-28-15-7-2-8-16-28)31(45-36)26-42-23-27-13-5-1-6-14-27/h1-22,31,33-36H,23-26H2,(H,38,40,41)/t31-,33+,34+,35-,36-/m1/s1 |
| InChIKey | YBJJWSDCNCGFLG-XWRKEFJQSA-N |
| XLogP | 4.64 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.66 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|