C36H31N3O4Se — CID 101100703
2-[(2S,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-phenylselanyl-2-(trityloxymethyl)oxolan-3-yl]acetonitrile (PubChem CID 101100703) has the molecular formula C36H31N3O4Se and a molecular weight of 648.62 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-phenylselanyl-2-(trityloxymethyl)oxolan-3-yl]acetonitrile.
| Compound Name | 2-[(2S,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-phenylselanyl-2-(trityloxymethyl)oxolan-3-yl]acetonitrile |
|---|---|
| PubChem CID | 101100703 |
| Molecular Formula | C36H31N3O4Se |
| Molecular Weight | 648.62 g/mol |
| Exact Mass | 649.15 |
| IUPAC Name | 2-[(2S,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-phenylselanyl-2-(trityloxymethyl)oxolan-3-yl]acetonitrile |
| SMILES | N#CC[C@H]1[C@@H]([Se]c2ccccc2)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H31N3O4Se/c37-23-21-30-31(43-34(39-24-22-32(40)38-35(39)41)33(30)44-29-19-11-4-12-20-29)25-42-36(26-13-5-1-6-14-26,27-15-7-2-8-16-27)28-17-9-3-10-18-28/h1-20,22,24,30-31,33-34H,21,25H2,(H,38,40,41)/t30-,31-,33-,34-/m1/s1 |
| InChIKey | ZVXKLOPBLGFTCP-SSZIUWPISA-N |
| XLogP | 4.79 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|