C38H36N2O6Se — CID 15730376
1-[(2R,3S,4S,5R)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-4-phenylselanyl-3-prop-2-enoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 15730376) has the molecular formula C38H36N2O6Se and a molecular weight of 695.67 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-4-phenylselanyl-3-prop-2-enoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4S,5R)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-4-phenylselanyl-3-prop-2-enoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15730376 |
| Molecular Formula | C38H36N2O6Se |
| Molecular Weight | 695.67 g/mol |
| Exact Mass | 696.17 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-4-phenylselanyl-3-prop-2-enoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=CCO[C@@H]1[C@@H]([Se]c2ccccc2)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C38H36N2O6Se/c1-3-25-44-34-35(47-31-17-11-6-12-18-31)32(46-36(34)40-24-23-33(41)39-37(40)42)26-45-38(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-19-21-30(43-2)22-20-29/h3-24,32,34-36H,1,25-26H2,2H3,(H,39,41,42)/t32-,34-,35+,36-/m1/s1 |
| InChIKey | HZTTWWKPAZFQRD-RQJNEPOFSA-N |
| XLogP | 4.84 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.67 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|