C36H33N3O5 — CID 14375699
1-[(1R,2R,4S,5S)-6-benzyl-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-oxa-6-azabicyclo[3.1.0]hexan-2-yl]pyrimidine-2,4-dione (PubChem CID 14375699) has the molecular formula C36H33N3O5 and a molecular weight of 587.68 g/mol. Its IUPAC name is 1-[(1R,2R,4S,5S)-6-benzyl-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-oxa-6-azabicyclo[3.1.0]hexan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R,2R,4S,5S)-6-benzyl-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-oxa-6-azabicyclo[3.1.0]hexan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 14375699 |
| Molecular Formula | C36H33N3O5 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | 1-[(1R,2R,4S,5S)-6-benzyl-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3-oxa-6-azabicyclo[3.1.0]hexan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H]3[C@@H]2N3Cc2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H33N3O5/c1-42-29-19-17-28(18-20-29)36(26-13-7-3-8-14-26,27-15-9-4-10-16-27)43-24-30-32-33(39(32)23-25-11-5-2-6-12-25)34(44-30)38-22-21-31(40)37-35(38)41/h2-22,30,32-34H,23-24H2,1H3,(H,37,40,41)/t30-,32-,33-,34-,39?/m1/s1 |
| InChIKey | GDOZQTYANWSDKC-ORGPSCQCSA-N |
| XLogP | 4.70 |
| TPSA | 85.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|