C33H35N3O7S — CID 100941507
[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-pyrrolidin-1-yl-2-(trityloxymethyl)oxolan-3-yl] methanesulfonate (PubChem CID 100941507) has the molecular formula C33H35N3O7S and a molecular weight of 617.72 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-pyrrolidin-1-yl-2-(trityloxymethyl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-pyrrolidin-1-yl-2-(trityloxymethyl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 100941507 |
| Molecular Formula | C33H35N3O7S |
| Molecular Weight | 617.72 g/mol |
| Exact Mass | 617.22 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-pyrrolidin-1-yl-2-(trityloxymethyl)oxolan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1[C@@H](N2CCCC2)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H35N3O7S/c1-44(39,40)43-30-27(42-31(29(30)35-20-11-12-21-35)36-22-19-28(37)34-32(36)38)23-41-33(24-13-5-2-6-14-24,25-15-7-3-8-16-25)26-17-9-4-10-18-26/h2-10,13-19,22,27,29-31H,11-12,20-21,23H2,1H3,(H,34,37,38)/t27-,29-,30+,31-/m1/s1 |
| InChIKey | WPELWEPWATWIPB-WPFAILKGSA-N |
| XLogP | 3.25 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|